C14H14N4O — CID 82481963
5-[2-(2-aminoethyl)pyrimidin-4-yl]-1,3-dihydroindol-2-one (PubChem CID 82481963) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 5-[2-(2-aminoethyl)pyrimidin-4-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-(2-aminoethyl)pyrimidin-4-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82481963 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 5-[2-(2-aminoethyl)pyrimidin-4-yl]-1,3-dihydroindol-2-one |
| SMILES | NCCc1nccc(-c2ccc3c(c2)CC(=O)N3)n1 |
| InChI | InChI=1S/C14H14N4O/c15-5-3-13-16-6-4-12(17-13)9-1-2-11-10(7-9)8-14(19)18-11/h1-2,4,6-7H,3,5,8,15H2,(H,18,19) |
| InChIKey | JNXHOXWTCLJFGW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |