C12H11N3OS — CID 82479021
5-[5-(aminomethyl)-1,2-thiazol-3-yl]-1,3-dihydroindol-2-one (PubChem CID 82479021) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 5-[5-(aminomethyl)-1,2-thiazol-3-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[5-(aminomethyl)-1,2-thiazol-3-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82479021 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 5-[5-(aminomethyl)-1,2-thiazol-3-yl]-1,3-dihydroindol-2-one |
| SMILES | NCc1cc(-c2ccc3c(c2)CC(=O)N3)ns1 |
| InChI | InChI=1S/C12H11N3OS/c13-6-9-5-11(15-17-9)7-1-2-10-8(3-7)4-12(16)14-10/h1-3,5H,4,6,13H2,(H,14,16) |
| InChIKey | PBWZGBFJOPRFGY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |