C18H15N5O2 — CID 9484477
5-[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]-1,3-dihydroindol-2-one (PubChem CID 9484477) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 5-[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 9484477 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 5-[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1ccc(-c2nnn(CC(=O)c3ccc4c(c3)CC(=O)N4)n2)cc1 |
| InChI | InChI=1S/C18H15N5O2/c1-11-2-4-12(5-3-11)18-20-22-23(21-18)10-16(24)13-6-7-15-14(8-13)9-17(25)19-15/h2-8H,9-10H2,1H3,(H,19,25) |
| InChIKey | PWRZYOTXHKMIQR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |