C16H12ClFN4O2 — CID 7489523
1-(3-chloro-4-methoxyphenyl)-2-[5-(4-fluorophenyl)tetrazol-2-yl]ethanone (PubChem CID 7489523) has the molecular formula C16H12ClFN4O2 and a molecular weight of 346.75 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[5-(4-fluorophenyl)tetrazol-2-yl]ethanone.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[5-(4-fluorophenyl)tetrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 7489523 |
| Molecular Formula | C16H12ClFN4O2 |
| Molecular Weight | 346.75 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[5-(4-fluorophenyl)tetrazol-2-yl]ethanone |
| SMILES | COc1ccc(C(=O)Cn2nnc(-c3ccc(F)cc3)n2)cc1Cl |
| InChI | InChI=1S/C16H12ClFN4O2/c1-24-15-7-4-11(8-13(15)17)14(23)9-22-20-16(19-21-22)10-2-5-12(18)6-3-10/h2-8H,9H2,1H3 |
| InChIKey | IPMBQXVXFGMBOA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.75 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |