C8H9Cl2NO2 — CID 86611692
6-chloro-1,3-dihydroindol-2-one;hydrate;hydrochloride (PubChem CID 86611692) has the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. Its IUPAC name is 6-chloro-1,3-dihydroindol-2-one;hydrate;hydrochloride.
| Compound Name | 6-chloro-1,3-dihydroindol-2-one;hydrate;hydrochloride |
|---|---|
| PubChem CID | 86611692 |
| Molecular Formula | C8H9Cl2NO2 |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | 6-chloro-1,3-dihydroindol-2-one;hydrate;hydrochloride |
| SMILES | Cl.O.O=C1Cc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C8H6ClNO.ClH.H2O/c9-6-2-1-5-3-8(11)10-7(5)4-6;;/h1-2,4H,3H2,(H,10,11);1H;1H2 |
| InChIKey | NELRPAAUWCMBSD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |