C17H12ClN3O2 — CID 167835849
6-chloro-N-(2-oxo-1,3-dihydroindol-6-yl)-1H-indole-3-carboxamide (PubChem CID 167835849) has the molecular formula C17H12ClN3O2 and a molecular weight of 325.76 g/mol. Its IUPAC name is 6-chloro-N-(2-oxo-1,3-dihydroindol-6-yl)-1H-indole-3-carboxamide.
| Compound Name | 6-chloro-N-(2-oxo-1,3-dihydroindol-6-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 167835849 |
| Molecular Formula | C17H12ClN3O2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 6-chloro-N-(2-oxo-1,3-dihydroindol-6-yl)-1H-indole-3-carboxamide |
| SMILES | O=C1Cc2ccc(NC(=O)c3c[nH]c4cc(Cl)ccc34)cc2N1 |
| InChI | InChI=1S/C17H12ClN3O2/c18-10-2-4-12-13(8-19-15(12)6-10)17(23)20-11-3-1-9-5-16(22)21-14(9)7-11/h1-4,6-8,19H,5H2,(H,20,23)(H,21,22) |
| InChIKey | LGRFNVVPIGLQFQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |