C15H8ClF3N2O — CID 113206499
6-chloro-N-(2,3,4-trifluorophenyl)-1H-indole-3-carboxamide (PubChem CID 113206499) has the molecular formula C15H8ClF3N2O and a molecular weight of 324.69 g/mol. Its IUPAC name is 6-chloro-N-(2,3,4-trifluorophenyl)-1H-indole-3-carboxamide.
| Compound Name | 6-chloro-N-(2,3,4-trifluorophenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206499 |
| Molecular Formula | C15H8ClF3N2O |
| Molecular Weight | 324.69 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 6-chloro-N-(2,3,4-trifluorophenyl)-1H-indole-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C15H8ClF3N2O/c16-7-1-2-8-9(6-20-12(8)5-7)15(22)21-11-4-3-10(17)13(18)14(11)19/h1-6,20H,(H,21,22) |
| InChIKey | XIBGCYIPIGVPAD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|