C11H11NO2 — CID 117281439
6-(1-hydroxycyclopropyl)-1,3-dihydroindol-2-one (PubChem CID 117281439) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 6-(1-hydroxycyclopropyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-(1-hydroxycyclopropyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 117281439 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 6-(1-hydroxycyclopropyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2ccc(C3(O)CC3)cc2N1 |
| InChI | InChI=1S/C11H11NO2/c13-10-5-7-1-2-8(6-9(7)12-10)11(14)3-4-11/h1-2,6,14H,3-5H2,(H,12,13) |
| InChIKey | YTZXBLARCNCSSI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |