C13H16N2O — CID 117308397
6-[1-(1-aminoethyl)cyclopropyl]-1,3-dihydroindol-2-one (PubChem CID 117308397) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 6-[1-(1-aminoethyl)cyclopropyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-[1-(1-aminoethyl)cyclopropyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 117308397 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 6-[1-(1-aminoethyl)cyclopropyl]-1,3-dihydroindol-2-one |
| SMILES | CC(N)C1(c2ccc3c(c2)NC(=O)C3)CC1 |
| InChI | InChI=1S/C13H16N2O/c1-8(14)13(4-5-13)10-3-2-9-6-12(16)15-11(9)7-10/h2-3,7-8H,4-6,14H2,1H3,(H,15,16) |
| InChIKey | IXPMRZQDOUWKSI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |