About 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one
7-chloro-1,4-dihydro-3,1-benzoxazin-2-one (PubChem CID 84769220) has the molecular formula C8H6ClNO2
and a molecular weight of 183.59 g/mol. Its IUPAC name is 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one |
| PubChem CID | 84769220 |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.59 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2CO1 |
| InChI | InChI=1S/C8H6ClNO2/c9-6-2-1-5-4-12-8(11)10-7(5)3-6/h1-3H,4H2,(H,10,11) |
| InChIKey | IPSHCFHBJHUIPH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one?
The IUPAC name of 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one (CID 84769220) is 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one.
What is the SMILES notation for 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one?
The canonical SMILES for 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one is O=C1Nc2cc(Cl)ccc2CO1.
What is the InChIKey of 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one?
The InChIKey is IPSHCFHBJHUIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO2/c9-6-2-1-5-4-12-8(11)10-7(5)3-6/h1-3H,4H2,(H,10,11).
What are the key properties of 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one?
7-chloro-1,4-dihydro-3,1-benzoxazin-2-one has a molecular weight of 183.59 g/mol, XLogP of 2.40, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one is sourced from PubChem (CID 84769220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).