C8H6ClNO2 — CID 84769220
7-chloro-1,4-dihydro-3,1-benzoxazin-2-one (PubChem CID 84769220) has the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. Its IUPAC name is 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one.
| Compound Name | 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 84769220 |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.59 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 7-chloro-1,4-dihydro-3,1-benzoxazin-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2CO1 |
| InChI | InChI=1S/C8H6ClNO2/c9-6-2-1-5-4-12-8(11)10-7(5)3-6/h1-3H,4H2,(H,10,11) |
| InChIKey | IPSHCFHBJHUIPH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |