C8H5ClO3 — CID 84769509
6-chloro-4H-1,3-benzodioxin-2-one (PubChem CID 84769509) has the molecular formula C8H5ClO3 and a molecular weight of 184.58 g/mol. Its IUPAC name is 6-chloro-4H-1,3-benzodioxin-2-one.
| Compound Name | 6-chloro-4H-1,3-benzodioxin-2-one |
|---|---|
| PubChem CID | 84769509 |
| Molecular Formula | C8H5ClO3 |
| Molecular Weight | 184.58 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | 6-chloro-4H-1,3-benzodioxin-2-one |
| SMILES | O=C1OCc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C8H5ClO3/c9-6-1-2-7-5(3-6)4-11-8(10)12-7/h1-3H,4H2 |
| InChIKey | PEGHRHKSACAPFA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|