C12H13ClO2 — CID 132551426
6-chloro-3-propan-2-yl-3,4-dihydrochromen-2-one (PubChem CID 132551426) has the molecular formula C12H13ClO2 and a molecular weight of 224.69 g/mol. Its IUPAC name is 6-chloro-3-propan-2-yl-3,4-dihydrochromen-2-one.
| Compound Name | 6-chloro-3-propan-2-yl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 132551426 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 6-chloro-3-propan-2-yl-3,4-dihydrochromen-2-one |
| SMILES | CC(C)C1Cc2cc(Cl)ccc2OC1=O |
| InChI | InChI=1S/C12H13ClO2/c1-7(2)10-6-8-5-9(13)3-4-11(8)15-12(10)14/h3-5,7,10H,6H2,1-2H3 |
| InChIKey | DDLPQMLJGLWTCY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|