C8H6BrClO — CID 142930046
(2S)-2-bromo-5-chloro-2,3-dihydro-1-benzofuran (PubChem CID 142930046) has the molecular formula C8H6BrClO and a molecular weight of 233.49 g/mol. Its IUPAC name is (2S)-2-bromo-5-chloro-2,3-dihydro-1-benzofuran.
| Compound Name | (2S)-2-bromo-5-chloro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 142930046 |
| Molecular Formula | C8H6BrClO |
| Molecular Weight | 233.49 g/mol |
| Exact Mass | 231.93 |
| IUPAC Name | (2S)-2-bromo-5-chloro-2,3-dihydro-1-benzofuran |
| SMILES | Clc1ccc2c(c1)C[C@H](Br)O2 |
| InChI | InChI=1S/C8H6BrClO/c9-8-4-5-3-6(10)1-2-7(5)11-8/h1-3,8H,4H2/t8-/m1/s1 |
| InChIKey | ORUOMRNIFYXPAY-MRVPVSSYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|