C15H13ClOSe — CID 56961244
5-chloro-2-(phenylselanylmethyl)-2,3-dihydro-1-benzofuran (PubChem CID 56961244) has the molecular formula C15H13ClOSe and a molecular weight of 323.68 g/mol. Its IUPAC name is 5-chloro-2-(phenylselanylmethyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 5-chloro-2-(phenylselanylmethyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 56961244 |
| Molecular Formula | C15H13ClOSe |
| Molecular Weight | 323.68 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 5-chloro-2-(phenylselanylmethyl)-2,3-dihydro-1-benzofuran |
| SMILES | Clc1ccc2c(c1)CC(C[Se]c1ccccc1)O2 |
| InChI | InChI=1S/C15H13ClOSe/c16-12-6-7-15-11(8-12)9-13(17-15)10-18-14-4-2-1-3-5-14/h1-8,13H,9-10H2 |
| InChIKey | BZQSYUAUEKACDI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|