C10H9ClO2 — CID 67297085
1-(5-chloro-2,3-dihydro-1-benzofuran-2-yl)ethanone (PubChem CID 67297085) has the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dihydro-1-benzofuran-2-yl)ethanone.
| Compound Name | 1-(5-chloro-2,3-dihydro-1-benzofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 67297085 |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 1-(5-chloro-2,3-dihydro-1-benzofuran-2-yl)ethanone |
| SMILES | CC(=O)C1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C10H9ClO2/c1-6(12)10-5-7-4-8(11)2-3-9(7)13-10/h2-4,10H,5H2,1H3 |
| InChIKey | LQQWLMOUBHRQQD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |