C9H8ClNO2 — CID 42920084
5-chloro-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 42920084) has the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 42920084 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 5-chloro-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)C1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C9H8ClNO2/c10-6-1-2-7-5(3-6)4-8(13-7)9(11)12/h1-3,8H,4H2,(H2,11,12) |
| InChIKey | YSRCNRWKDNXNHD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |