C16H20ClNO2 — CID 8006571
(2R)-5-chloro-N-cycloheptyl-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 8006571) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is (2R)-5-chloro-N-cycloheptyl-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2R)-5-chloro-N-cycloheptyl-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8006571 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (2R)-5-chloro-N-cycloheptyl-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC1CCCCCC1)[C@H]1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C16H20ClNO2/c17-12-7-8-14-11(9-12)10-15(20-14)16(19)18-13-5-3-1-2-4-6-13/h7-9,13,15H,1-6,10H2,(H,18,19)/t15-/m1/s1 |
| InChIKey | FHNZHOBLXQFXFH-OAHLLOKOSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |