C13H10ClN3O2 — CID 42893127
5-chloro-N-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 42893127) has the molecular formula C13H10ClN3O2 and a molecular weight of 275.69 g/mol. Its IUPAC name is 5-chloro-N-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 42893127 |
| Molecular Formula | C13H10ClN3O2 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 5-chloro-N-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ncccn1)C1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C13H10ClN3O2/c14-9-2-3-10-8(6-9)7-11(19-10)12(18)17-13-15-4-1-5-16-13/h1-6,11H,7H2,(H,15,16,17,18) |
| InChIKey | QAFKZAINOQAECC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |