C13H11ClN4O2 — CID 94104892
(2S)-5-chloro-N'-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-carbohydrazide (PubChem CID 94104892) has the molecular formula C13H11ClN4O2 and a molecular weight of 290.71 g/mol. Its IUPAC name is (2S)-5-chloro-N'-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-carbohydrazide.
| Compound Name | (2S)-5-chloro-N'-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 94104892 |
| Molecular Formula | C13H11ClN4O2 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (2S)-5-chloro-N'-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-carbohydrazide |
| SMILES | O=C(NNc1ncccn1)[C@@H]1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C13H11ClN4O2/c14-9-2-3-10-8(6-9)7-11(20-10)12(19)17-18-13-15-4-1-5-16-13/h1-6,11H,7H2,(H,17,19)(H,15,16,18)/t11-/m0/s1 |
| InChIKey | LSSSUGRSJVXZHE-NSHDSACASA-N |
| XLogP | 1.58 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|