C15H15ClN4O2 — CID 51081170
5-chloro-N-[2-(pyrimidin-2-ylamino)ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 51081170) has the molecular formula C15H15ClN4O2 and a molecular weight of 318.76 g/mol. Its IUPAC name is 5-chloro-N-[2-(pyrimidin-2-ylamino)ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(pyrimidin-2-ylamino)ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 51081170 |
| Molecular Formula | C15H15ClN4O2 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 5-chloro-N-[2-(pyrimidin-2-ylamino)ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCNc1ncccn1)C1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C15H15ClN4O2/c16-11-2-3-12-10(8-11)9-13(22-12)14(21)17-6-7-20-15-18-4-1-5-19-15/h1-5,8,13H,6-7,9H2,(H,17,21)(H,18,19,20) |
| InChIKey | BCTBWZHRSCWULA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|