C15H16ClN3O2 — CID 94183027
(2S)-5-chloro-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 94183027) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is (2S)-5-chloro-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2S)-5-chloro-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 94183027 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2S)-5-chloro-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)[C@@H]1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-12-2-3-13-11(8-12)9-14(21-13)15(20)18-4-1-6-19-7-5-17-10-19/h2-3,5,7-8,10,14H,1,4,6,9H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | IXSCECJZUUMCKO-AWEZNQCLSA-N |
| XLogP | 2.05 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|