C18H13ClN2O2 — CID 39995800
(2R)-5-chloro-N-isoquinolin-5-yl-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 39995800) has the molecular formula C18H13ClN2O2 and a molecular weight of 324.77 g/mol. Its IUPAC name is (2R)-5-chloro-N-isoquinolin-5-yl-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2R)-5-chloro-N-isoquinolin-5-yl-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 39995800 |
| Molecular Formula | C18H13ClN2O2 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | (2R)-5-chloro-N-isoquinolin-5-yl-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1cccc2cnccc12)[C@H]1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C18H13ClN2O2/c19-13-4-5-16-12(8-13)9-17(23-16)18(22)21-15-3-1-2-11-10-20-7-6-14(11)15/h1-8,10,17H,9H2,(H,21,22)/t17-/m1/s1 |
| InChIKey | ZADKSKJJUBYLRW-QGZVFWFLSA-N |
| XLogP | 3.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |