C13H10ClN3O2 — CID 95157077
(2R)-5-chloro-N,N-bis(cyanomethyl)-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 95157077) has the molecular formula C13H10ClN3O2 and a molecular weight of 275.69 g/mol. Its IUPAC name is (2R)-5-chloro-N,N-bis(cyanomethyl)-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2R)-5-chloro-N,N-bis(cyanomethyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 95157077 |
| Molecular Formula | C13H10ClN3O2 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (2R)-5-chloro-N,N-bis(cyanomethyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)[C@H]1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C13H10ClN3O2/c14-10-1-2-11-9(7-10)8-12(19-11)13(18)17(5-3-15)6-4-16/h1-2,7,12H,5-6,8H2/t12-/m1/s1 |
| InChIKey | BMBPZGAHBISQHL-GFCCVEGCSA-N |
| XLogP | 1.52 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|