C10H7ClO4 — CID 175653078
6-chloro-2-oxo-3,4-dihydrochromene-3-carboxylic acid (PubChem CID 175653078) has the molecular formula C10H7ClO4 and a molecular weight of 226.61 g/mol. Its IUPAC name is 6-chloro-2-oxo-3,4-dihydrochromene-3-carboxylic acid.
| Compound Name | 6-chloro-2-oxo-3,4-dihydrochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 175653078 |
| Molecular Formula | C10H7ClO4 |
| Molecular Weight | 226.61 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 6-chloro-2-oxo-3,4-dihydrochromene-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2cc(Cl)ccc2OC1=O |
| InChI | InChI=1S/C10H7ClO4/c11-6-1-2-8-5(3-6)4-7(9(12)13)10(14)15-8/h1-3,7H,4H2,(H,12,13) |
| InChIKey | HNZGIDDAQGOTML-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.61 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|