C12H9ClO2 — CID 10846599
8-chloro-3,4-dihydro-1H-cyclopenta[c]chromen-2-one (PubChem CID 10846599) has the molecular formula C12H9ClO2 and a molecular weight of 220.66 g/mol. Its IUPAC name is 8-chloro-3,4-dihydro-1H-cyclopenta[c]chromen-2-one.
| Compound Name | 8-chloro-3,4-dihydro-1H-cyclopenta[c]chromen-2-one |
|---|---|
| PubChem CID | 10846599 |
| Molecular Formula | C12H9ClO2 |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 8-chloro-3,4-dihydro-1H-cyclopenta[c]chromen-2-one |
| SMILES | O=C1CC2=C(C1)c1cc(Cl)ccc1OC2 |
| InChI | InChI=1S/C12H9ClO2/c13-8-1-2-12-11(4-8)10-5-9(14)3-7(10)6-15-12/h1-2,4H,3,5-6H2 |
| InChIKey | RCNGQMFWHAAICK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |