C12H8Cl2O2 — CID 70162180
5-(2,5-dichlorophenyl)cyclohex-4-ene-1,3-dione (PubChem CID 70162180) has the molecular formula C12H8Cl2O2 and a molecular weight of 255.10 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)cyclohex-4-ene-1,3-dione.
| Compound Name | 5-(2,5-dichlorophenyl)cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 70162180 |
| Molecular Formula | C12H8Cl2O2 |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 5-(2,5-dichlorophenyl)cyclohex-4-ene-1,3-dione |
| SMILES | O=C1C=C(c2cc(Cl)ccc2Cl)CC(=O)C1 |
| InChI | InChI=1S/C12H8Cl2O2/c13-8-1-2-12(14)11(5-8)7-3-9(15)6-10(16)4-7/h1-3,5H,4,6H2 |
| InChIKey | CRSCAMTUTXEVAM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|