C8H7ClN2O2 — CID 91010488
6-chloro-2-hydroxy-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 91010488) has the molecular formula C8H7ClN2O2 and a molecular weight of 198.61 g/mol. Its IUPAC name is 6-chloro-2-hydroxy-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 6-chloro-2-hydroxy-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 91010488 |
| Molecular Formula | C8H7ClN2O2 |
| Molecular Weight | 198.61 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 6-chloro-2-hydroxy-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C8H7ClN2O2/c9-4-1-2-6-5(3-4)7(12)11-8(13)10-6/h1-3,8,10,13H,(H,11,12) |
| InChIKey | DAYWCJVKHPRLKP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.61 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |