C9H6ClN3O4 — CID 23354292
8-chloro-3-nitro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (PubChem CID 23354292) has the molecular formula C9H6ClN3O4 and a molecular weight of 255.62 g/mol. Its IUPAC name is 8-chloro-3-nitro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 8-chloro-3-nitro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 23354292 |
| Molecular Formula | C9H6ClN3O4 |
| Molecular Weight | 255.62 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 8-chloro-3-nitro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| SMILES | O=C1NC([N+](=O)[O-])C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H6ClN3O4/c10-4-1-2-5-6(3-4)11-9(15)7(13(16)17)12-8(5)14/h1-3,7H,(H,11,15)(H,12,14) |
| InChIKey | BPQKMURHRSSTKB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.62 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|