C13H14ClN3O2 — CID 163154833
(6aR,8S)-8-amino-3-chloro-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-6,12-dione (PubChem CID 163154833) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is (6aR,8S)-8-amino-3-chloro-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-6,12-dione.
| Compound Name | (6aR,8S)-8-amino-3-chloro-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-6,12-dione |
|---|---|
| PubChem CID | 163154833 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (6aR,8S)-8-amino-3-chloro-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-6,12-dione |
| SMILES | N[C@H]1CCN2C(=O)c3ccc(Cl)cc3NC(=O)[C@H]2C1 |
| InChI | InChI=1S/C13H14ClN3O2/c14-7-1-2-9-10(5-7)16-12(18)11-6-8(15)3-4-17(11)13(9)19/h1-2,5,8,11H,3-4,6,15H2,(H,16,18)/t8-,11+/m0/s1 |
| InChIKey | ORUGOVLYMUVIST-GZMMTYOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |