C16H19ClN4O3 — CID 163142557
N-[(6aS,8R)-3-chloro-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-(methylamino)acetamide (PubChem CID 163142557) has the molecular formula C16H19ClN4O3 and a molecular weight of 350.81 g/mol. Its IUPAC name is N-[(6aS,8R)-3-chloro-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-(methylamino)acetamide.
| Compound Name | N-[(6aS,8R)-3-chloro-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 163142557 |
| Molecular Formula | C16H19ClN4O3 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-[(6aS,8R)-3-chloro-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)N[C@@H]1CCN2C(=O)c3ccc(Cl)cc3NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C16H19ClN4O3/c1-18-8-14(22)19-10-4-5-21-13(7-10)15(23)20-12-6-9(17)2-3-11(12)16(21)24/h2-3,6,10,13,18H,4-5,7-8H2,1H3,(H,19,22)(H,20,23)/t10-,13+/m1/s1 |
| InChIKey | KIGAVZCSHSTZCI-MFKMUULPSA-N |
| XLogP | 0.60 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |