C24H27ClN4O4 — CID 9424312
1-[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3-propan-2-ylurea (PubChem CID 9424312) has the molecular formula C24H27ClN4O4 and a molecular weight of 470.96 g/mol. Its IUPAC name is 1-[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3-propan-2-ylurea.
| Compound Name | 1-[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 9424312 |
| Molecular Formula | C24H27ClN4O4 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 1-[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3-propan-2-ylurea |
| SMILES | COc1ccc(Cl)cc1-c1ccc2c(c1)C(=O)N1CC[C@H](NC(=O)NC(C)C)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C24H27ClN4O4/c1-13(2)26-24(32)27-16-8-9-29-20(12-16)22(30)28-19-6-4-14(10-18(19)23(29)31)17-11-15(25)5-7-21(17)33-3/h4-7,10-11,13,16,20H,8-9,12H2,1-3H3,(H,28,30)(H2,26,27,32)/t16-,20-/m0/s1 |
| InChIKey | TWXKMYQKIWQCNT-JXFKEZNVSA-N |
| XLogP | 3.65 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |