C25H27ClN4O4 — CID 11866415
(2R)-N-[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]pyrrolidine-2-carboxamide (PubChem CID 11866415) has the molecular formula C25H27ClN4O4 and a molecular weight of 482.97 g/mol. Its IUPAC name is (2R)-N-[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11866415 |
| Molecular Formula | C25H27ClN4O4 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (2R)-N-[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1-c1ccc2c(c1)C(=O)N1CC[C@H](NC(=O)[C@H]3CCCN3)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C25H27ClN4O4/c1-34-22-7-5-15(26)12-17(22)14-4-6-19-18(11-14)25(33)30-10-8-16(13-21(30)24(32)29-19)28-23(31)20-3-2-9-27-20/h4-7,11-12,16,20-21,27H,2-3,8-10,13H2,1H3,(H,28,31)(H,29,32)/t16-,20+,21-/m0/s1 |
| InChIKey | BXSOPNGMMDKMGE-DQLDELGASA-N |
| XLogP | 2.81 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |