C25H24ClN5O4 — CID 11866019
N-[(6aS,7S)-2-(5-chloro-2-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-1,5-dimethylpyrazole-3-carboxamide (PubChem CID 11866019) has the molecular formula C25H24ClN5O4 and a molecular weight of 493.95 g/mol. Its IUPAC name is N-[(6aS,7S)-2-(5-chloro-2-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-1,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[(6aS,7S)-2-(5-chloro-2-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-1,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 11866019 |
| Molecular Formula | C25H24ClN5O4 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | N-[(6aS,7S)-2-(5-chloro-2-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-1,5-dimethylpyrazole-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1-c1ccc2c(c1)C(=O)N1CC[C@H](NC(=O)c3cc(C)n(C)n3)[C@H]1C(=O)N2 |
| InChI | InChI=1S/C25H24ClN5O4/c1-13-10-20(29-30(13)2)23(32)28-19-8-9-31-22(19)24(33)27-18-6-4-14(11-17(18)25(31)34)16-12-15(26)5-7-21(16)35-3/h4-7,10-12,19,22H,8-9H2,1-3H3,(H,27,33)(H,28,32)/t19-,22-/m0/s1 |
| InChIKey | OIEGLNSHLYMATR-UGKGYDQZSA-N |
| XLogP | 3.02 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |