C24H21ClN2O4S — CID 3749875
2-(5-chloro-2-methoxyphenyl)-7-(furan-2-ylmethylsulfanyl)-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 3749875) has the molecular formula C24H21ClN2O4S and a molecular weight of 468.96 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-7-(furan-2-ylmethylsulfanyl)-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-7-(furan-2-ylmethylsulfanyl)-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 3749875 |
| Molecular Formula | C24H21ClN2O4S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-7-(furan-2-ylmethylsulfanyl)-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | COc1ccc(Cl)cc1-c1ccc2c(c1)C(=O)N1CCC(SCc3ccco3)C1C(=O)N2 |
| InChI | InChI=1S/C24H21ClN2O4S/c1-30-20-7-5-15(25)12-17(20)14-4-6-19-18(11-14)24(29)27-9-8-21(22(27)23(28)26-19)32-13-16-3-2-10-31-16/h2-7,10-12,21-22H,8-9,13H2,1H3,(H,26,28) |
| InChIKey | PFYIVZQXDSNAKZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |