C22H24ClN4O4+ — CID 9421159
[2-[[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium (PubChem CID 9421159) has the molecular formula C22H24ClN4O4+ and a molecular weight of 443.91 g/mol. Its IUPAC name is [2-[[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium.
| Compound Name | [2-[[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9421159 |
| Molecular Formula | C22H24ClN4O4+ |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [2-[[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium |
| SMILES | C[NH2+]CC(=O)N[C@H]1C[C@H]2C(=O)Nc3ccc(-c4cc(Cl)ccc4OC)cc3C(=O)N2C1 |
| InChI | InChI=1S/C22H23ClN4O4/c1-24-10-20(28)25-14-9-18-21(29)26-17-5-3-12(7-16(17)22(30)27(18)11-14)15-8-13(23)4-6-19(15)31-2/h3-8,14,18,24H,9-11H2,1-2H3,(H,25,28)(H,26,29)/p+1/t14-,18-/m0/s1 |
| InChIKey | XOIUKMRZCKJXAA-KSSFIOAISA-O |
| XLogP | 0.86 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |