C23H24F3N4O3+ — CID 7134933
[2-[[(6aS,8S)-6,12-dioxo-2-[3-(trifluoromethyl)phenyl]-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium (PubChem CID 7134933) has the molecular formula C23H24F3N4O3+ and a molecular weight of 461.46 g/mol. Its IUPAC name is [2-[[(6aS,8S)-6,12-dioxo-2-[3-(trifluoromethyl)phenyl]-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium.
| Compound Name | [2-[[(6aS,8S)-6,12-dioxo-2-[3-(trifluoromethyl)phenyl]-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 7134933 |
| Molecular Formula | C23H24F3N4O3+ |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | [2-[[(6aS,8S)-6,12-dioxo-2-[3-(trifluoromethyl)phenyl]-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]amino]-2-oxoethyl]-methylazanium |
| SMILES | C[NH2+]CC(=O)N[C@H]1CCN2C(=O)c3cc(-c4cccc(C(F)(F)F)c4)ccc3NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C23H23F3N4O3/c1-27-12-20(31)28-16-7-8-30-19(11-16)21(32)29-18-6-5-14(10-17(18)22(30)33)13-3-2-4-15(9-13)23(24,25)26/h2-6,9-10,16,19,27H,7-8,11-12H2,1H3,(H,28,31)(H,29,32)/p+1/t16-,19-/m0/s1 |
| InChIKey | NMQTVWLNADOQEK-LPHOPBHVSA-O |
| XLogP | 1.61 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |