C28H24F3N3O4 — CID 7134888
N-[(6aS,8S)-6,12-dioxo-2-[3-(trifluoromethyl)phenyl]-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-methoxybenzamide (PubChem CID 7134888) has the molecular formula C28H24F3N3O4 and a molecular weight of 523.51 g/mol. Its IUPAC name is N-[(6aS,8S)-6,12-dioxo-2-[3-(trifluoromethyl)phenyl]-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-methoxybenzamide.
| Compound Name | N-[(6aS,8S)-6,12-dioxo-2-[3-(trifluoromethyl)phenyl]-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 7134888 |
| Molecular Formula | C28H24F3N3O4 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | N-[(6aS,8S)-6,12-dioxo-2-[3-(trifluoromethyl)phenyl]-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2CCN3C(=O)c4cc(-c5cccc(C(F)(F)F)c5)ccc4NC(=O)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C28H24F3N3O4/c1-38-21-8-5-16(6-9-21)25(35)32-20-11-12-34-24(15-20)26(36)33-23-10-7-18(14-22(23)27(34)37)17-3-2-4-19(13-17)28(29,30)31/h2-10,13-14,20,24H,11-12,15H2,1H3,(H,32,35)(H,33,36)/t20-,24-/m0/s1 |
| InChIKey | IIIYLQGJHLGSLK-RDPSFJRHSA-N |
| XLogP | 4.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |