C29H30N4O4 — CID 163174984
N-[(6aS,8R)-2-(4-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-(dimethylamino)benzamide (PubChem CID 163174984) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[(6aS,8R)-2-(4-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-(dimethylamino)benzamide.
| Compound Name | N-[(6aS,8R)-2-(4-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 163174984 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-[(6aS,8R)-2-(4-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-4-(dimethylamino)benzamide |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2CC[C@@H](NC(=O)c4ccc(N(C)C)cc4)C[C@H]2C(=O)N3)cc1 |
| InChI | InChI=1S/C29H30N4O4/c1-32(2)22-9-4-19(5-10-22)27(34)30-21-14-15-33-26(17-21)28(35)31-25-13-8-20(16-24(25)29(33)36)18-6-11-23(37-3)12-7-18/h4-13,16,21,26H,14-15,17H2,1-3H3,(H,30,34)(H,31,35)/t21-,26+/m1/s1 |
| InChIKey | WXEXKXBFYWHIAG-RLWLMLJZSA-N |
| XLogP | 3.78 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |