C19H20N3O3+ — CID 7662158
(4aR)-9-(4-methoxyphenyl)-1,2,3,4,4a,6-hexahydropyrazino[2,1-c][1,4]benzodiazepin-3-ium-5,11-dione (PubChem CID 7662158) has the molecular formula C19H20N3O3+ and a molecular weight of 338.39 g/mol. Its IUPAC name is (4aR)-9-(4-methoxyphenyl)-1,2,3,4,4a,6-hexahydropyrazino[2,1-c][1,4]benzodiazepin-3-ium-5,11-dione.
| Compound Name | (4aR)-9-(4-methoxyphenyl)-1,2,3,4,4a,6-hexahydropyrazino[2,1-c][1,4]benzodiazepin-3-ium-5,11-dione |
|---|---|
| PubChem CID | 7662158 |
| Molecular Formula | C19H20N3O3+ |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (4aR)-9-(4-methoxyphenyl)-1,2,3,4,4a,6-hexahydropyrazino[2,1-c][1,4]benzodiazepin-3-ium-5,11-dione |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2CC[NH2+]C[C@@H]2C(=O)N3)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-25-14-5-2-12(3-6-14)13-4-7-16-15(10-13)19(24)22-9-8-20-11-17(22)18(23)21-16/h2-7,10,17,20H,8-9,11H2,1H3,(H,21,23)/p+1/t17-/m1/s1 |
| InChIKey | FGNSNJATWRJWJW-QGZVFWFLSA-O |
| XLogP | 0.70 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |