C26H25N3O5S — CID 3744084
N-[2-(4-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-4-methylbenzenesulfonamide (PubChem CID 3744084) has the molecular formula C26H25N3O5S and a molecular weight of 491.57 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(4-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3744084 |
| Molecular Formula | C26H25N3O5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2CCC(NS(=O)(=O)c4ccc(C)cc4)C2C(=O)N3)cc1 |
| InChI | InChI=1S/C26H25N3O5S/c1-16-3-10-20(11-4-16)35(32,33)28-23-13-14-29-24(23)25(30)27-22-12-7-18(15-21(22)26(29)31)17-5-8-19(34-2)9-6-17/h3-12,15,23-24,28H,13-14H2,1-2H3,(H,27,30) |
| InChIKey | OBTPNRKPWNCFDF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |