C23H21N3O5S2 — CID 73138509
9-(4-methoxyphenyl)-3-thiophen-2-ylsulfonyl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 73138509) has the molecular formula C23H21N3O5S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is 9-(4-methoxyphenyl)-3-thiophen-2-ylsulfonyl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | 9-(4-methoxyphenyl)-3-thiophen-2-ylsulfonyl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 73138509 |
| Molecular Formula | C23H21N3O5S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 9-(4-methoxyphenyl)-3-thiophen-2-ylsulfonyl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2CCN(S(=O)(=O)c4cccs4)CC2C(=O)N3)cc1 |
| InChI | InChI=1S/C23H21N3O5S2/c1-31-17-7-4-15(5-8-17)16-6-9-19-18(13-16)23(28)26-11-10-25(14-20(26)22(27)24-19)33(29,30)21-3-2-12-32-21/h2-9,12-13,20H,10-11,14H2,1H3,(H,24,27) |
| InChIKey | DGHBXUYYBPRAEI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |