C20H17N3O4S3 — CID 73148144
N-(6,11-dioxo-2-thiophen-2-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl)thiophene-2-sulfonamide (PubChem CID 73148144) has the molecular formula C20H17N3O4S3 and a molecular weight of 459.57 g/mol. Its IUPAC name is N-(6,11-dioxo-2-thiophen-2-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl)thiophene-2-sulfonamide.
| Compound Name | N-(6,11-dioxo-2-thiophen-2-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 73148144 |
| Molecular Formula | C20H17N3O4S3 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | N-(6,11-dioxo-2-thiophen-2-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl)thiophene-2-sulfonamide |
| SMILES | O=C1Nc2ccc(-c3cccs3)cc2C(=O)N2CCC(NS(=O)(=O)c3cccs3)C12 |
| InChI | InChI=1S/C20H17N3O4S3/c24-19-18-15(22-30(26,27)17-4-2-10-29-17)7-8-23(18)20(25)13-11-12(5-6-14(13)21-19)16-3-1-9-28-16/h1-6,9-11,15,18,22H,7-8H2,(H,21,24) |
| InChIKey | TUSMSCOWCMPILV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |