C21H17N3O3S2 — CID 11941497
N-[(6aS,7S)-6,11-dioxo-2-thiophen-3-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide (PubChem CID 11941497) has the molecular formula C21H17N3O3S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[(6aS,7S)-6,11-dioxo-2-thiophen-3-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide.
| Compound Name | N-[(6aS,7S)-6,11-dioxo-2-thiophen-3-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11941497 |
| Molecular Formula | C21H17N3O3S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | N-[(6aS,7S)-6,11-dioxo-2-thiophen-3-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1CCN2C(=O)c3cc(-c4ccsc4)ccc3NC(=O)[C@H]12)c1cccs1 |
| InChI | InChI=1S/C21H17N3O3S2/c25-19(17-2-1-8-29-17)23-16-5-7-24-18(16)20(26)22-15-4-3-12(10-14(15)21(24)27)13-6-9-28-11-13/h1-4,6,8-11,16,18H,5,7H2,(H,22,26)(H,23,25)/t16-,18-/m0/s1 |
| InChIKey | YQNKHGKMOXILDD-WMZOPIPTSA-N |
| XLogP | 3.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |