C19H18N2O3S — CID 163132574
(6aS,7S)-7-prop-2-enoxy-2-thiophen-3-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 163132574) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is (6aS,7S)-7-prop-2-enoxy-2-thiophen-3-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | (6aS,7S)-7-prop-2-enoxy-2-thiophen-3-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 163132574 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (6aS,7S)-7-prop-2-enoxy-2-thiophen-3-yl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | C=CCO[C@H]1CCN2C(=O)c3cc(-c4ccsc4)ccc3NC(=O)[C@H]12 |
| InChI | InChI=1S/C19H18N2O3S/c1-2-8-24-16-5-7-21-17(16)18(22)20-15-4-3-12(10-14(15)19(21)23)13-6-9-25-11-13/h2-4,6,9-11,16-17H,1,5,7-8H2,(H,20,22)/t16-,17-/m0/s1 |
| InChIKey | GSFBKQZOHTVALG-IRXDYDNUSA-N |
| XLogP | 3.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|