C25H24N4O5S — CID 3781545
N-(3,5-dimethoxyphenyl)-5,11-dioxo-9-thiophen-3-yl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide (PubChem CID 3781545) has the molecular formula C25H24N4O5S and a molecular weight of 492.56 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-5,11-dioxo-9-thiophen-3-yl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-5,11-dioxo-9-thiophen-3-yl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 3781545 |
| Molecular Formula | C25H24N4O5S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-5,11-dioxo-9-thiophen-3-yl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCN3C(=O)c4cc(-c5ccsc5)ccc4NC(=O)C3C2)cc(OC)c1 |
| InChI | InChI=1S/C25H24N4O5S/c1-33-18-10-17(11-19(12-18)34-2)26-25(32)28-6-7-29-22(13-28)23(30)27-21-4-3-15(9-20(21)24(29)31)16-5-8-35-14-16/h3-5,8-12,14,22H,6-7,13H2,1-2H3,(H,26,32)(H,27,30) |
| InChIKey | RIJCTDYOQQBNSK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |