C26H31N3O5 — CID 78451948
9-(2,4-dimethoxyphenyl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 78451948) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 9-(2,4-dimethoxyphenyl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | 9-(2,4-dimethoxyphenyl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 78451948 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 9-(2,4-dimethoxyphenyl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2CCN(C(=O)CC(C)(C)C)CC2C(=O)N3)c(OC)c1 |
| InChI | InChI=1S/C26H31N3O5/c1-26(2,3)14-23(30)28-10-11-29-21(15-28)24(31)27-20-9-6-16(12-19(20)25(29)32)18-8-7-17(33-4)13-22(18)34-5/h6-9,12-13,21H,10-11,14-15H2,1-5H3,(H,27,31) |
| InChIKey | WMUHGYYIYVQSDO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |