C28H31N3O6 — CID 11884527
2-[1-[2-[(4aS)-9-(4-methoxyphenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]cyclopentyl]acetic acid (PubChem CID 11884527) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is 2-[1-[2-[(4aS)-9-(4-methoxyphenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[2-[(4aS)-9-(4-methoxyphenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 11884527 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 2-[1-[2-[(4aS)-9-(4-methoxyphenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]cyclopentyl]acetic acid |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2CCN(C(=O)CC4(CC(=O)O)CCCC4)C[C@H]2C(=O)N3)cc1 |
| InChI | InChI=1S/C28H31N3O6/c1-37-20-7-4-18(5-8-20)19-6-9-22-21(14-19)27(36)31-13-12-30(17-23(31)26(35)29-22)24(32)15-28(16-25(33)34)10-2-3-11-28/h4-9,14,23H,2-3,10-13,15-17H2,1H3,(H,29,35)(H,33,34)/t23-/m0/s1 |
| InChIKey | JVYRSNACJDSVAZ-QHCPKHFHSA-N |
| XLogP | 3.39 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |