C25H26N3O5S- — CID 7135493
2-[1-[2-[(4aR)-5,11-dioxo-9-thiophen-3-yl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]cyclopentyl]acetate (PubChem CID 7135493) has the molecular formula C25H26N3O5S- and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-[1-[2-[(4aR)-5,11-dioxo-9-thiophen-3-yl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]cyclopentyl]acetate.
| Compound Name | 2-[1-[2-[(4aR)-5,11-dioxo-9-thiophen-3-yl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 7135493 |
| Molecular Formula | C25H26N3O5S- |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-[1-[2-[(4aR)-5,11-dioxo-9-thiophen-3-yl-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]cyclopentyl]acetate |
| SMILES | O=C([O-])CC1(CC(=O)N2CCN3C(=O)c4cc(-c5ccsc5)ccc4NC(=O)[C@H]3C2)CCCC1 |
| InChI | InChI=1S/C25H27N3O5S/c29-21(12-25(13-22(30)31)6-1-2-7-25)27-8-9-28-20(14-27)23(32)26-19-4-3-16(11-18(19)24(28)33)17-5-10-34-15-17/h3-5,10-11,15,20H,1-2,6-9,12-14H2,(H,26,32)(H,30,31)/p-1/t20-/m1/s1 |
| InChIKey | ZYKWNGZJAIBJFN-HXUWFJFHSA-M |
| XLogP | 2.11 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |