C22H24ClN3O3S — CID 67499023
9-(5-chlorothiophen-2-yl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 67499023) has the molecular formula C22H24ClN3O3S and a molecular weight of 445.97 g/mol. Its IUPAC name is 9-(5-chlorothiophen-2-yl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | 9-(5-chlorothiophen-2-yl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 67499023 |
| Molecular Formula | C22H24ClN3O3S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 9-(5-chlorothiophen-2-yl)-3-(3,3-dimethylbutanoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | CC(C)(C)CC(=O)N1CCN2C(=O)c3cc(-c4ccc(Cl)s4)ccc3NC(=O)C2C1 |
| InChI | InChI=1S/C22H24ClN3O3S/c1-22(2,3)11-19(27)25-8-9-26-16(12-25)20(28)24-15-5-4-13(10-14(15)21(26)29)17-6-7-18(23)30-17/h4-7,10,16H,8-9,11-12H2,1-3H3,(H,24,28) |
| InChIKey | YERFIDHKBWNMCZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |