C25H28ClN3O3 — CID 3729993
N-[2-(4-chlorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3,3-dimethylbutanamide (PubChem CID 3729993) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-(4-chlorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 3729993 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[2-(4-chlorophenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NC1CCN2C(=O)c3cc(-c4ccc(Cl)cc4)ccc3NC(=O)C2C1 |
| InChI | InChI=1S/C25H28ClN3O3/c1-25(2,3)14-22(30)27-18-10-11-29-21(13-18)23(31)28-20-9-6-16(12-19(20)24(29)32)15-4-7-17(26)8-5-15/h4-9,12,18,21H,10-11,13-14H2,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | ARQIVEWBSAHYNY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |